C24H33N5O3Si — CID 162516483
N-[1-[4-[2-[tert-butyl(dimethyl)silyl]oxybutyl]phenyl]-2-oxopyrimidin-4-yl]imidazole-1-carboxamide (PubChem CID 162516483) has the molecular formula C24H33N5O3Si and a molecular weight of 467.65 g/mol. Its IUPAC name is N-[1-[4-[2-[tert-butyl(dimethyl)silyl]oxybutyl]phenyl]-2-oxopyrimidin-4-yl]imidazole-1-carboxamide.
| Compound Name | N-[1-[4-[2-[tert-butyl(dimethyl)silyl]oxybutyl]phenyl]-2-oxopyrimidin-4-yl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 162516483 |
| Molecular Formula | C24H33N5O3Si |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | N-[1-[4-[2-[tert-butyl(dimethyl)silyl]oxybutyl]phenyl]-2-oxopyrimidin-4-yl]imidazole-1-carboxamide |
| SMILES | CCC(Cc1ccc(-n2ccc(NC(=O)n3ccnc3)nc2=O)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H33N5O3Si/c1-7-20(32-33(5,6)24(2,3)4)16-18-8-10-19(11-9-18)29-14-12-21(27-23(29)31)26-22(30)28-15-13-25-17-28/h8-15,17,20H,7,16H2,1-6H3,(H,26,27,30,31) |
| InChIKey | OKDCFJNKAQHLLM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|