C17H23BF3NO4 — CID 162516561
N-methoxy-N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]acetamide (PubChem CID 162516561) has the molecular formula C17H23BF3NO4 and a molecular weight of 373.18 g/mol. Its IUPAC name is N-methoxy-N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-methoxy-N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 162516561 |
| Molecular Formula | C17H23BF3NO4 |
| Molecular Weight | 373.18 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-methoxy-N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CON(C)C(=O)Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H23BF3NO4/c1-15(2)16(3,4)26-18(25-15)12-8-7-11(9-14(23)22(5)24-6)13(10-12)17(19,20)21/h7-8,10H,9H2,1-6H3 |
| InChIKey | QWIBUBBZSLQXHV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|