About [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] hexanoate
[(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] hexanoate (PubChem CID 162517806) has the molecular formula C30H60O3Si
and a molecular weight of 496.89 g/mol. Its IUPAC name is [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] hexanoate.
Molecular Properties
| Compound Name | [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] hexanoate |
| PubChem CID | 162517806 |
| Molecular Formula | C30H60O3Si |
| Molecular Weight | 496.89 g/mol |
| Exact Mass | 496.43 |
| IUPAC Name | [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] hexanoate |
| SMILES | CCCCCC[C@H](C/C=C\CCCCCCCCO[Si](C)(C)C(C)(C)C)OC(=O)CCCCC |
| InChI | InChI=1S/C30H60O3Si/c1-8-10-12-21-24-28(33-29(31)26-20-11-9-2)25-22-18-16-14-13-15-17-19-23-27-32-34(6,7)30(3,4)5/h18,22,28H,8-17,19-21,23-27H2,1-7H3/b22-18-/t28-/m1/s1 |
| InChIKey | UCPRBWPZBTZICB-HDMCSNSISA-N |
| XLogP | 10.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.89 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] hexanoate?
The IUPAC name of [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] hexanoate (CID 162517806) is [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] hexanoate.
What is the SMILES notation for [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] hexanoate?
The canonical SMILES for [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] hexanoate is CCCCCC[C@H](C/C=C\CCCCCCCCO[Si](C)(C)C(C)(C)C)OC(=O)CCCCC.
What is the InChIKey of [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] hexanoate?
The InChIKey is UCPRBWPZBTZICB-HDMCSNSISA-N. The full InChI is InChI=1S/C30H60O3Si/c1-8-10-12-21-24-28(33-29(31)26-20-11-9-2)25-22-18-16-14-13-15-17-19-23-27-32-34(6,7)30(3,4)5/h18,22,28H,8-17,19-21,23-27H2,1-7H3/b22-18-/t28-/m1/s1.
What are the key properties of [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] hexanoate?
[(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] hexanoate has a molecular weight of 496.89 g/mol, XLogP of 10.15, 22 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] hexanoate is sourced from PubChem (CID 162517806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).