C16H33IO5Si — CID 162517829
triethyl-[(2S,3S,4R)-1-iodo-2,4-bis(methoxymethoxy)hex-5-en-3-yl]oxysilane (PubChem CID 162517829) has the molecular formula C16H33IO5Si and a molecular weight of 460.43 g/mol. Its IUPAC name is triethyl-[(2S,3S,4R)-1-iodo-2,4-bis(methoxymethoxy)hex-5-en-3-yl]oxysilane.
| Compound Name | triethyl-[(2S,3S,4R)-1-iodo-2,4-bis(methoxymethoxy)hex-5-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 162517829 |
| Molecular Formula | C16H33IO5Si |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | triethyl-[(2S,3S,4R)-1-iodo-2,4-bis(methoxymethoxy)hex-5-en-3-yl]oxysilane |
| SMILES | C=C[C@@H](OCOC)[C@H](O[Si](CC)(CC)CC)[C@@H](CI)OCOC |
| InChI | InChI=1S/C16H33IO5Si/c1-7-14(20-12-18-5)16(15(11-17)21-13-19-6)22-23(8-2,9-3)10-4/h7,14-16H,1,8-13H2,2-6H3/t14-,15-,16+/m1/s1 |
| InChIKey | DYIIQGRWVVBRLS-OAGGEKHMSA-N |
| XLogP | 3.98 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|