C17H30O7 — CID 162517831
(3R,4R,5R)-3,5-bis(methoxymethoxy)-4-[3-(methoxymethoxy)propoxy]oct-1-en-7-yne (PubChem CID 162517831) has the molecular formula C17H30O7 and a molecular weight of 346.42 g/mol. Its IUPAC name is (3R,4R,5R)-3,5-bis(methoxymethoxy)-4-[3-(methoxymethoxy)propoxy]oct-1-en-7-yne.
| Compound Name | (3R,4R,5R)-3,5-bis(methoxymethoxy)-4-[3-(methoxymethoxy)propoxy]oct-1-en-7-yne |
|---|---|
| PubChem CID | 162517831 |
| Molecular Formula | C17H30O7 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (3R,4R,5R)-3,5-bis(methoxymethoxy)-4-[3-(methoxymethoxy)propoxy]oct-1-en-7-yne |
| SMILES | C#CC[C@@H](OCOC)[C@@H](OCCCOCOC)[C@@H](C=C)OCOC |
| InChI | InChI=1S/C17H30O7/c1-6-9-16(24-14-20-5)17(15(7-2)23-13-19-4)22-11-8-10-21-12-18-3/h1,7,15-17H,2,8-14H2,3-5H3/t15-,16-,17+/m1/s1 |
| InChIKey | RWNYNLDBUISQLI-ZACQAIPSSA-N |
| XLogP | 1.57 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|