C16H5F4N3O2 — CID 162518137
5-(4-cyano-1,1,2,2-tetrafluoro-3-oxoinden-5-yl)oxypyridine-3-carbonitrile (PubChem CID 162518137) has the molecular formula C16H5F4N3O2 and a molecular weight of 347.23 g/mol. Its IUPAC name is 5-(4-cyano-1,1,2,2-tetrafluoro-3-oxoinden-5-yl)oxypyridine-3-carbonitrile.
| Compound Name | 5-(4-cyano-1,1,2,2-tetrafluoro-3-oxoinden-5-yl)oxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 162518137 |
| Molecular Formula | C16H5F4N3O2 |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 5-(4-cyano-1,1,2,2-tetrafluoro-3-oxoinden-5-yl)oxypyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(Oc2ccc3c(c2C#N)C(=O)C(F)(F)C3(F)F)c1 |
| InChI | InChI=1S/C16H5F4N3O2/c17-15(18)11-1-2-12(25-9-3-8(4-21)6-23-7-9)10(5-22)13(11)14(24)16(15,19)20/h1-3,6-7H |
| InChIKey | XLDMKBXNNHWZMN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|