C19H20ClN5O — CID 162518223
(2S)-1-[(8-chloropyrido[3,4-d]pyrimidin-4-yl)amino]-3-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol (PubChem CID 162518223) has the molecular formula C19H20ClN5O and a molecular weight of 369.86 g/mol. Its IUPAC name is (2S)-1-[(8-chloropyrido[3,4-d]pyrimidin-4-yl)amino]-3-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol.
| Compound Name | (2S)-1-[(8-chloropyrido[3,4-d]pyrimidin-4-yl)amino]-3-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 162518223 |
| Molecular Formula | C19H20ClN5O |
| Molecular Weight | 369.86 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (2S)-1-[(8-chloropyrido[3,4-d]pyrimidin-4-yl)amino]-3-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol |
| SMILES | O[C@@H](CNc1ncnc2c(Cl)nccc12)CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H20ClN5O/c20-18-17-16(5-7-21-18)19(24-12-23-17)22-9-15(26)11-25-8-6-13-3-1-2-4-14(13)10-25/h1-5,7,12,15,26H,6,8-11H2,(H,22,23,24)/t15-/m0/s1 |
| InChIKey | GTAYHMYILYCQJW-HNNXBMFYSA-N |
| XLogP | 2.51 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.86 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|