About 5-(trifluoromethyl)-1,6-dihydropyrazolo[4,5-d]pyrimidin-7-one
5-(trifluoromethyl)-1,6-dihydropyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 162518235) has the molecular formula C6H3F3N4O
and a molecular weight of 204.11 g/mol. Its IUPAC name is 5-(trifluoromethyl)-1,6-dihydropyrazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-(trifluoromethyl)-1,6-dihydropyrazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 162518235 |
| Molecular Formula | C6H3F3N4O |
| Molecular Weight | 204.11 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 5-(trifluoromethyl)-1,6-dihydropyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=c1[nH]c(C(F)(F)F)nc2cn[nH]c12 |
| InChI | InChI=1S/C6H3F3N4O/c7-6(8,9)5-11-2-1-10-13-3(2)4(14)12-5/h1H,(H,10,13)(H,11,12,14) |
| InChIKey | UYPSXKHEEJANPL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.11 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(trifluoromethyl)-1,6-dihydropyrazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(trifluoromethyl)-1,6-dihydropyrazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 5-(trifluoromethyl)-1,6-dihydropyrazolo[4,5-d]pyrimidin-7-one (CID 162518235) is 5-(trifluoromethyl)-1,6-dihydropyrazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 5-(trifluoromethyl)-1,6-dihydropyrazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 5-(trifluoromethyl)-1,6-dihydropyrazolo[4,5-d]pyrimidin-7-one is O=c1[nH]c(C(F)(F)F)nc2cn[nH]c12.
What is the InChIKey of 5-(trifluoromethyl)-1,6-dihydropyrazolo[4,5-d]pyrimidin-7-one?
The InChIKey is UYPSXKHEEJANPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F3N4O/c7-6(8,9)5-11-2-1-10-13-3(2)4(14)12-5/h1H,(H,10,13)(H,11,12,14).
What are the key properties of 5-(trifluoromethyl)-1,6-dihydropyrazolo[4,5-d]pyrimidin-7-one?
5-(trifluoromethyl)-1,6-dihydropyrazolo[4,5-d]pyrimidin-7-one has a molecular weight of 204.11 g/mol, XLogP of 0.67, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(trifluoromethyl)-1,6-dihydropyrazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 162518235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).