C8H14N3O3Y- — CID 162519154
amino-[4-carboxy-4-(prop-2-enoylamino)butyl]azanide;yttrium (PubChem CID 162519154) has the molecular formula C8H14N3O3Y- and a molecular weight of 289.12 g/mol. Its IUPAC name is amino-[4-carboxy-4-(prop-2-enoylamino)butyl]azanide;yttrium.
| Compound Name | amino-[4-carboxy-4-(prop-2-enoylamino)butyl]azanide;yttrium |
|---|---|
| PubChem CID | 162519154 |
| Molecular Formula | C8H14N3O3Y- |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | amino-[4-carboxy-4-(prop-2-enoylamino)butyl]azanide;yttrium |
| SMILES | C=CC(=O)NC(CCC[N-]N)C(=O)O.[Y] |
| InChI | InChI=1S/C8H14N3O3.Y/c1-2-7(12)11-6(8(13)14)4-3-5-10-9;/h2,6H,1,3-5,9H2,(H,11,12)(H,13,14);/q-1; |
| InChIKey | WFGPVMGRKORNFE-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 106.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|