About [2-(4-tert-butylanilino)-6-chlorophenyl] thiohypoiodite;ethane
[2-(4-tert-butylanilino)-6-chlorophenyl] thiohypoiodite;ethane (PubChem CID 162519294) has the molecular formula C18H23ClINS
and a molecular weight of 447.81 g/mol. Its IUPAC name is [2-(4-tert-butylanilino)-6-chlorophenyl] thiohypoiodite;ethane.
Molecular Properties
| Compound Name | [2-(4-tert-butylanilino)-6-chlorophenyl] thiohypoiodite;ethane |
| PubChem CID | 162519294 |
| Molecular Formula | C18H23ClINS |
| Molecular Weight | 447.81 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | [2-(4-tert-butylanilino)-6-chlorophenyl] thiohypoiodite;ethane |
| SMILES | CC.CC(C)(C)c1ccc(Nc2cccc(Cl)c2SI)cc1 |
| InChI | InChI=1S/C16H17ClINS.C2H6/c1-16(2,3)11-7-9-12(10-8-11)19-14-6-4-5-13(17)15(14)20-18;1-2/h4-10,19H,1-3H3;1-2H3 |
| InChIKey | UXSYBZDBGCOOFQ-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.81 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-tert-butylanilino)-6-chlorophenyl] thiohypoiodite;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-tert-butylanilino)-6-chlorophenyl] thiohypoiodite;ethane?
The IUPAC name of [2-(4-tert-butylanilino)-6-chlorophenyl] thiohypoiodite;ethane (CID 162519294) is [2-(4-tert-butylanilino)-6-chlorophenyl] thiohypoiodite;ethane.
What is the SMILES notation for [2-(4-tert-butylanilino)-6-chlorophenyl] thiohypoiodite;ethane?
The canonical SMILES for [2-(4-tert-butylanilino)-6-chlorophenyl] thiohypoiodite;ethane is CC.CC(C)(C)c1ccc(Nc2cccc(Cl)c2SI)cc1.
What is the InChIKey of [2-(4-tert-butylanilino)-6-chlorophenyl] thiohypoiodite;ethane?
The InChIKey is UXSYBZDBGCOOFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClINS.C2H6/c1-16(2,3)11-7-9-12(10-8-11)19-14-6-4-5-13(17)15(14)20-18;1-2/h4-10,19H,1-3H3;1-2H3.
What are the key properties of [2-(4-tert-butylanilino)-6-chlorophenyl] thiohypoiodite;ethane?
[2-(4-tert-butylanilino)-6-chlorophenyl] thiohypoiodite;ethane has a molecular weight of 447.81 g/mol, XLogP of 7.85, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-tert-butylanilino)-6-chlorophenyl] thiohypoiodite;ethane is sourced from PubChem (CID 162519294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).