About 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoic acid
2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoic acid (PubChem CID 162519436) has the molecular formula C14H8FNO3
and a molecular weight of 257.22 g/mol. Its IUPAC name is 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoic acid.
Molecular Properties
| Compound Name | 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoic acid |
| PubChem CID | 162519436 |
| Molecular Formula | C14H8FNO3 |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoic acid |
| SMILES | O=C(O)c1ccc(-c2nccc3occc23)cc1F |
| InChI | InChI=1S/C14H8FNO3/c15-11-7-8(1-2-9(11)14(17)18)13-10-4-6-19-12(10)3-5-16-13/h1-7H,(H,17,18) |
| InChIKey | KHCGGJNMXOEEFO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoic acid?
The IUPAC name of 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoic acid (CID 162519436) is 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoic acid.
What is the SMILES notation for 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoic acid?
The canonical SMILES for 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoic acid is O=C(O)c1ccc(-c2nccc3occc23)cc1F.
What is the InChIKey of 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoic acid?
The InChIKey is KHCGGJNMXOEEFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8FNO3/c15-11-7-8(1-2-9(11)14(17)18)13-10-4-6-19-12(10)3-5-16-13/h1-7H,(H,17,18).
What are the key properties of 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoic acid?
2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoic acid has a molecular weight of 257.22 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoic acid is sourced from PubChem (CID 162519436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).