C15H13N3O — CID 162519663
N-methyl-4-(1H-pyrrolo[3,2-c]pyridin-4-yl)benzamide (PubChem CID 162519663) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is N-methyl-4-(1H-pyrrolo[3,2-c]pyridin-4-yl)benzamide.
| Compound Name | N-methyl-4-(1H-pyrrolo[3,2-c]pyridin-4-yl)benzamide |
|---|---|
| PubChem CID | 162519663 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | N-methyl-4-(1H-pyrrolo[3,2-c]pyridin-4-yl)benzamide |
| SMILES | CNC(=O)c1ccc(-c2nccc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C15H13N3O/c1-16-15(19)11-4-2-10(3-5-11)14-12-6-8-17-13(12)7-9-18-14/h2-9,17H,1H3,(H,16,19) |
| InChIKey | JTSOLRJDKUZTTC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |