About (6-chloro-4,5-dimethylpyridazin-3-yl)methanol
(6-chloro-4,5-dimethylpyridazin-3-yl)methanol (PubChem CID 162520191) has the molecular formula C7H9ClN2O
and a molecular weight of 172.61 g/mol. Its IUPAC name is (6-chloro-4,5-dimethylpyridazin-3-yl)methanol.
Molecular Properties
| Compound Name | (6-chloro-4,5-dimethylpyridazin-3-yl)methanol |
| PubChem CID | 162520191 |
| Molecular Formula | C7H9ClN2O |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | (6-chloro-4,5-dimethylpyridazin-3-yl)methanol |
| SMILES | Cc1c(Cl)nnc(CO)c1C |
| InChI | InChI=1S/C7H9ClN2O/c1-4-5(2)7(8)10-9-6(4)3-11/h11H,3H2,1-2H3 |
| InChIKey | JGZOYMVJVGDAPE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-chloro-4,5-dimethylpyridazin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-4,5-dimethylpyridazin-3-yl)methanol?
The IUPAC name of (6-chloro-4,5-dimethylpyridazin-3-yl)methanol (CID 162520191) is (6-chloro-4,5-dimethylpyridazin-3-yl)methanol.
What is the SMILES notation for (6-chloro-4,5-dimethylpyridazin-3-yl)methanol?
The canonical SMILES for (6-chloro-4,5-dimethylpyridazin-3-yl)methanol is Cc1c(Cl)nnc(CO)c1C.
What is the InChIKey of (6-chloro-4,5-dimethylpyridazin-3-yl)methanol?
The InChIKey is JGZOYMVJVGDAPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O/c1-4-5(2)7(8)10-9-6(4)3-11/h11H,3H2,1-2H3.
What are the key properties of (6-chloro-4,5-dimethylpyridazin-3-yl)methanol?
(6-chloro-4,5-dimethylpyridazin-3-yl)methanol has a molecular weight of 172.61 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-4,5-dimethylpyridazin-3-yl)methanol is sourced from PubChem (CID 162520191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).