C17H17ClF4N4O3 — CID 162520587
N-[(3-chloro-4-fluorophenyl)-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]-3-formamido-2-methoxypropanamide (PubChem CID 162520587) has the molecular formula C17H17ClF4N4O3 and a molecular weight of 436.79 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]-3-formamido-2-methoxypropanamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]-3-formamido-2-methoxypropanamide |
|---|---|
| PubChem CID | 162520587 |
| Molecular Formula | C17H17ClF4N4O3 |
| Molecular Weight | 436.79 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]-3-formamido-2-methoxypropanamide |
| SMILES | COC(CNC=O)C(=O)NC(c1ccc(F)c(Cl)c1)c1cnn(CC(F)(F)F)c1 |
| InChI | InChI=1S/C17H17ClF4N4O3/c1-29-14(6-23-9-27)16(28)25-15(10-2-3-13(19)12(18)4-10)11-5-24-26(7-11)8-17(20,21)22/h2-5,7,9,14-15H,6,8H2,1H3,(H,23,27)(H,25,28) |
| InChIKey | DFBOZWXEMBEERW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.79 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|