C19H19Cl2N3O3 — CID 162520742
(4R)-N-[bis(4-chlorophenyl)methyl]-3-(2-hydroxyethyl)-2-oxoimidazolidine-4-carboxamide (PubChem CID 162520742) has the molecular formula C19H19Cl2N3O3 and a molecular weight of 408.29 g/mol. Its IUPAC name is (4R)-N-[bis(4-chlorophenyl)methyl]-3-(2-hydroxyethyl)-2-oxoimidazolidine-4-carboxamide.
| Compound Name | (4R)-N-[bis(4-chlorophenyl)methyl]-3-(2-hydroxyethyl)-2-oxoimidazolidine-4-carboxamide |
|---|---|
| PubChem CID | 162520742 |
| Molecular Formula | C19H19Cl2N3O3 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (4R)-N-[bis(4-chlorophenyl)methyl]-3-(2-hydroxyethyl)-2-oxoimidazolidine-4-carboxamide |
| SMILES | O=C(NC(c1ccc(Cl)cc1)c1ccc(Cl)cc1)[C@H]1CNC(=O)N1CCO |
| InChI | InChI=1S/C19H19Cl2N3O3/c20-14-5-1-12(2-6-14)17(13-3-7-15(21)8-4-13)23-18(26)16-11-22-19(27)24(16)9-10-25/h1-8,16-17,25H,9-11H2,(H,22,27)(H,23,26)/t16-/m1/s1 |
| InChIKey | NRQSHEIPTYBZAA-MRXNPFEDSA-N |
| XLogP | 2.59 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |