C22H21N5O3S — CID 162521246
2-(2-aminoethyl)-N-[4-(phenylsulfamoyl)phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 162521246) has the molecular formula C22H21N5O3S and a molecular weight of 435.51 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-[4-(phenylsulfamoyl)phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-(2-aminoethyl)-N-[4-(phenylsulfamoyl)phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 162521246 |
| Molecular Formula | C22H21N5O3S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-(2-aminoethyl)-N-[4-(phenylsulfamoyl)phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | NCCc1nc2ccc(C(=O)Nc3ccc(S(=O)(=O)Nc4ccccc4)cc3)cc2[nH]1 |
| InChI | InChI=1S/C22H21N5O3S/c23-13-12-21-25-19-11-6-15(14-20(19)26-21)22(28)24-16-7-9-18(10-8-16)31(29,30)27-17-4-2-1-3-5-17/h1-11,14,27H,12-13,23H2,(H,24,28)(H,25,26) |
| InChIKey | KORABOWPOWTNKA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |