About ethane;3-(4-ethenyl-2-methyl-6-oxo-5-prop-1-en-2-ylpyrimidin-1-yl)piperidine-2,6-dione
ethane;3-(4-ethenyl-2-methyl-6-oxo-5-prop-1-en-2-ylpyrimidin-1-yl)piperidine-2,6-dione (PubChem CID 162522044) has the molecular formula C17H23N3O3
and a molecular weight of 317.39 g/mol. Its IUPAC name is ethane;3-(4-ethenyl-2-methyl-6-oxo-5-prop-1-en-2-ylpyrimidin-1-yl)piperidine-2,6-dione.
Molecular Properties
| Compound Name | ethane;3-(4-ethenyl-2-methyl-6-oxo-5-prop-1-en-2-ylpyrimidin-1-yl)piperidine-2,6-dione |
| PubChem CID | 162522044 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | ethane;3-(4-ethenyl-2-methyl-6-oxo-5-prop-1-en-2-ylpyrimidin-1-yl)piperidine-2,6-dione |
| SMILES | C=Cc1nc(C)n(C2CCC(=O)NC2=O)c(=O)c1C(=C)C.CC |
| InChI | InChI=1S/C15H17N3O3.C2H6/c1-5-10-13(8(2)3)15(21)18(9(4)16-10)11-6-7-12(19)17-14(11)20;1-2/h5,11H,1-2,6-7H2,3-4H3,(H,17,19,20);1-2H3 |
| InChIKey | WBJBAJDWQYDUPF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-(4-ethenyl-2-methyl-6-oxo-5-prop-1-en-2-ylpyrimidin-1-yl)piperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(4-ethenyl-2-methyl-6-oxo-5-prop-1-en-2-ylpyrimidin-1-yl)piperidine-2,6-dione?
The IUPAC name of ethane;3-(4-ethenyl-2-methyl-6-oxo-5-prop-1-en-2-ylpyrimidin-1-yl)piperidine-2,6-dione (CID 162522044) is ethane;3-(4-ethenyl-2-methyl-6-oxo-5-prop-1-en-2-ylpyrimidin-1-yl)piperidine-2,6-dione.
What is the SMILES notation for ethane;3-(4-ethenyl-2-methyl-6-oxo-5-prop-1-en-2-ylpyrimidin-1-yl)piperidine-2,6-dione?
The canonical SMILES for ethane;3-(4-ethenyl-2-methyl-6-oxo-5-prop-1-en-2-ylpyrimidin-1-yl)piperidine-2,6-dione is C=Cc1nc(C)n(C2CCC(=O)NC2=O)c(=O)c1C(=C)C.CC.
What is the InChIKey of ethane;3-(4-ethenyl-2-methyl-6-oxo-5-prop-1-en-2-ylpyrimidin-1-yl)piperidine-2,6-dione?
The InChIKey is WBJBAJDWQYDUPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O3.C2H6/c1-5-10-13(8(2)3)15(21)18(9(4)16-10)11-6-7-12(19)17-14(11)20;1-2/h5,11H,1-2,6-7H2,3-4H3,(H,17,19,20);1-2H3.
What are the key properties of ethane;3-(4-ethenyl-2-methyl-6-oxo-5-prop-1-en-2-ylpyrimidin-1-yl)piperidine-2,6-dione?
ethane;3-(4-ethenyl-2-methyl-6-oxo-5-prop-1-en-2-ylpyrimidin-1-yl)piperidine-2,6-dione has a molecular weight of 317.39 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(4-ethenyl-2-methyl-6-oxo-5-prop-1-en-2-ylpyrimidin-1-yl)piperidine-2,6-dione is sourced from PubChem (CID 162522044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).