C14H21N3O3S — CID 162522063
N-[5-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-2-formylthiophen-3-yl]propanamide;methoxymethane (PubChem CID 162522063) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is N-[5-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-2-formylthiophen-3-yl]propanamide;methoxymethane.
| Compound Name | N-[5-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-2-formylthiophen-3-yl]propanamide;methoxymethane |
|---|---|
| PubChem CID | 162522063 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-[5-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-2-formylthiophen-3-yl]propanamide;methoxymethane |
| SMILES | CCC(=O)Nc1cc(C(/C=C\N)=C/N)sc1C=O.COC |
| InChI | InChI=1S/C12H15N3O2S.C2H6O/c1-2-12(17)15-9-5-10(18-11(9)7-16)8(6-14)3-4-13;1-3-2/h3-7H,2,13-14H2,1H3,(H,15,17);1-2H3/b4-3-,8-6+; |
| InChIKey | GHHOWOUWNAEXPX-FCDMEJJGSA-N |
| XLogP | 1.94 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|