C28H30N3+ — CID 162522207
N,N-dimethyl-2-[3-(4-phenylphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]aniline (PubChem CID 162522207) has the molecular formula C28H30N3+ and a molecular weight of 408.57 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-(4-phenylphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]aniline.
| Compound Name | N,N-dimethyl-2-[3-(4-phenylphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]aniline |
|---|---|
| PubChem CID | 162522207 |
| Molecular Formula | C28H30N3+ |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | N,N-dimethyl-2-[3-(4-phenylphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]aniline |
| SMILES | CN(C)c1ccccc1-[n+]1cc(-c2ccc(-c3ccccc3)cc2)n2c1CCCCC2 |
| InChI | InChI=1S/C28H30N3/c1-29(2)25-13-8-9-14-26(25)31-21-27(30-20-10-4-7-15-28(30)31)24-18-16-23(17-19-24)22-11-5-3-6-12-22/h3,5-6,8-9,11-14,16-19,21H,4,7,10,15,20H2,1-2H3/q+1 |
| InChIKey | RWLAAESUWFXTEC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|