About 2-[3,5-dichloro-2-fluoro-4-[(2-fluoro-3-propan-2-ylphenyl)methyl]anilino]acetamide
2-[3,5-dichloro-2-fluoro-4-[(2-fluoro-3-propan-2-ylphenyl)methyl]anilino]acetamide (PubChem CID 162522701) has the molecular formula C18H18Cl2F2N2O
and a molecular weight of 387.26 g/mol. Its IUPAC name is 2-[3,5-dichloro-2-fluoro-4-[(2-fluoro-3-propan-2-ylphenyl)methyl]anilino]acetamide.
Molecular Properties
| Compound Name | 2-[3,5-dichloro-2-fluoro-4-[(2-fluoro-3-propan-2-ylphenyl)methyl]anilino]acetamide |
| PubChem CID | 162522701 |
| Molecular Formula | C18H18Cl2F2N2O |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-[3,5-dichloro-2-fluoro-4-[(2-fluoro-3-propan-2-ylphenyl)methyl]anilino]acetamide |
| SMILES | CC(C)c1cccc(Cc2c(Cl)cc(NCC(N)=O)c(F)c2Cl)c1F |
| InChI | InChI=1S/C18H18Cl2F2N2O/c1-9(2)11-5-3-4-10(17(11)21)6-12-13(19)7-14(18(22)16(12)20)24-8-15(23)25/h3-5,7,9,24H,6,8H2,1-2H3,(H2,23,25) |
| InChIKey | RCSRYFAFZRRTBE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-dichloro-2-fluoro-4-[(2-fluoro-3-propan-2-ylphenyl)methyl]anilino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dichloro-2-fluoro-4-[(2-fluoro-3-propan-2-ylphenyl)methyl]anilino]acetamide?
The IUPAC name of 2-[3,5-dichloro-2-fluoro-4-[(2-fluoro-3-propan-2-ylphenyl)methyl]anilino]acetamide (CID 162522701) is 2-[3,5-dichloro-2-fluoro-4-[(2-fluoro-3-propan-2-ylphenyl)methyl]anilino]acetamide.
What is the SMILES notation for 2-[3,5-dichloro-2-fluoro-4-[(2-fluoro-3-propan-2-ylphenyl)methyl]anilino]acetamide?
The canonical SMILES for 2-[3,5-dichloro-2-fluoro-4-[(2-fluoro-3-propan-2-ylphenyl)methyl]anilino]acetamide is CC(C)c1cccc(Cc2c(Cl)cc(NCC(N)=O)c(F)c2Cl)c1F.
What is the InChIKey of 2-[3,5-dichloro-2-fluoro-4-[(2-fluoro-3-propan-2-ylphenyl)methyl]anilino]acetamide?
The InChIKey is RCSRYFAFZRRTBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Cl2F2N2O/c1-9(2)11-5-3-4-10(17(11)21)6-12-13(19)7-14(18(22)16(12)20)24-8-15(23)25/h3-5,7,9,24H,6,8H2,1-2H3,(H2,23,25).
What are the key properties of 2-[3,5-dichloro-2-fluoro-4-[(2-fluoro-3-propan-2-ylphenyl)methyl]anilino]acetamide?
2-[3,5-dichloro-2-fluoro-4-[(2-fluoro-3-propan-2-ylphenyl)methyl]anilino]acetamide has a molecular weight of 387.26 g/mol, XLogP of 4.88, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dichloro-2-fluoro-4-[(2-fluoro-3-propan-2-ylphenyl)methyl]anilino]acetamide is sourced from PubChem (CID 162522701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).