About 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]anilino]acetyl chloride
2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]anilino]acetyl chloride (PubChem CID 162522792) has the molecular formula C18H17Cl3FNO2
and a molecular weight of 404.70 g/mol. Its IUPAC name is 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]anilino]acetyl chloride.
Molecular Properties
| Compound Name | 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]anilino]acetyl chloride |
| PubChem CID | 162522792 |
| Molecular Formula | C18H17Cl3FNO2 |
| Molecular Weight | 404.70 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]anilino]acetyl chloride |
| SMILES | CC(C)c1cc(Cc2c(Cl)cc(NCC(=O)Cl)c(F)c2Cl)ccc1O |
| InChI | InChI=1S/C18H17Cl3FNO2/c1-9(2)11-5-10(3-4-15(11)24)6-12-13(19)7-14(18(22)17(12)21)23-8-16(20)25/h3-5,7,9,23-24H,6,8H2,1-2H3 |
| InChIKey | CPNVPTFFIILLAW-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.70 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]anilino]acetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]anilino]acetyl chloride?
The IUPAC name of 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]anilino]acetyl chloride (CID 162522792) is 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]anilino]acetyl chloride.
What is the SMILES notation for 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]anilino]acetyl chloride?
The canonical SMILES for 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]anilino]acetyl chloride is CC(C)c1cc(Cc2c(Cl)cc(NCC(=O)Cl)c(F)c2Cl)ccc1O.
What is the InChIKey of 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]anilino]acetyl chloride?
The InChIKey is CPNVPTFFIILLAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl3FNO2/c1-9(2)11-5-10(3-4-15(11)24)6-12-13(19)7-14(18(22)17(12)21)23-8-16(20)25/h3-5,7,9,23-24H,6,8H2,1-2H3.
What are the key properties of 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]anilino]acetyl chloride?
2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]anilino]acetyl chloride has a molecular weight of 404.70 g/mol, XLogP of 5.73, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]anilino]acetyl chloride is sourced from PubChem (CID 162522792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).