About methyl (E)-4-[3,5-dichloro-4-[[4-(oxan-2-yloxy)-3-propan-2-ylphenyl]methyl]phenyl]but-3-enoate
methyl (E)-4-[3,5-dichloro-4-[[4-(oxan-2-yloxy)-3-propan-2-ylphenyl]methyl]phenyl]but-3-enoate (PubChem CID 162522824) has the molecular formula C26H30Cl2O4
and a molecular weight of 477.43 g/mol. Its IUPAC name is methyl (E)-4-[3,5-dichloro-4-[[4-(oxan-2-yloxy)-3-propan-2-ylphenyl]methyl]phenyl]but-3-enoate.
Molecular Properties
| Compound Name | methyl (E)-4-[3,5-dichloro-4-[[4-(oxan-2-yloxy)-3-propan-2-ylphenyl]methyl]phenyl]but-3-enoate |
| PubChem CID | 162522824 |
| Molecular Formula | C26H30Cl2O4 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | methyl (E)-4-[3,5-dichloro-4-[[4-(oxan-2-yloxy)-3-propan-2-ylphenyl]methyl]phenyl]but-3-enoate |
| SMILES | COC(=O)C/C=C/c1cc(Cl)c(Cc2ccc(OC3CCCCO3)c(C(C)C)c2)c(Cl)c1 |
| InChI | InChI=1S/C26H30Cl2O4/c1-17(2)20-13-19(10-11-24(20)32-26-9-4-5-12-31-26)14-21-22(27)15-18(16-23(21)28)7-6-8-25(29)30-3/h6-7,10-11,13,15-17,26H,4-5,8-9,12,14H2,1-3H3/b7-6+ |
| InChIKey | ZLOQZFISOZRWRM-VOTSOKGWSA-N |
| XLogP | 7.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (E)-4-[3,5-dichloro-4-[[4-(oxan-2-yloxy)-3-propan-2-ylphenyl]methyl]phenyl]but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-4-[3,5-dichloro-4-[[4-(oxan-2-yloxy)-3-propan-2-ylphenyl]methyl]phenyl]but-3-enoate?
The IUPAC name of methyl (E)-4-[3,5-dichloro-4-[[4-(oxan-2-yloxy)-3-propan-2-ylphenyl]methyl]phenyl]but-3-enoate (CID 162522824) is methyl (E)-4-[3,5-dichloro-4-[[4-(oxan-2-yloxy)-3-propan-2-ylphenyl]methyl]phenyl]but-3-enoate.
What is the SMILES notation for methyl (E)-4-[3,5-dichloro-4-[[4-(oxan-2-yloxy)-3-propan-2-ylphenyl]methyl]phenyl]but-3-enoate?
The canonical SMILES for methyl (E)-4-[3,5-dichloro-4-[[4-(oxan-2-yloxy)-3-propan-2-ylphenyl]methyl]phenyl]but-3-enoate is COC(=O)C/C=C/c1cc(Cl)c(Cc2ccc(OC3CCCCO3)c(C(C)C)c2)c(Cl)c1.
What is the InChIKey of methyl (E)-4-[3,5-dichloro-4-[[4-(oxan-2-yloxy)-3-propan-2-ylphenyl]methyl]phenyl]but-3-enoate?
The InChIKey is ZLOQZFISOZRWRM-VOTSOKGWSA-N. The full InChI is InChI=1S/C26H30Cl2O4/c1-17(2)20-13-19(10-11-24(20)32-26-9-4-5-12-31-26)14-21-22(27)15-18(16-23(21)28)7-6-8-25(29)30-3/h6-7,10-11,13,15-17,26H,4-5,8-9,12,14H2,1-3H3/b7-6+.
What are the key properties of methyl (E)-4-[3,5-dichloro-4-[[4-(oxan-2-yloxy)-3-propan-2-ylphenyl]methyl]phenyl]but-3-enoate?
methyl (E)-4-[3,5-dichloro-4-[[4-(oxan-2-yloxy)-3-propan-2-ylphenyl]methyl]phenyl]but-3-enoate has a molecular weight of 477.43 g/mol, XLogP of 7.19, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-4-[3,5-dichloro-4-[[4-(oxan-2-yloxy)-3-propan-2-ylphenyl]methyl]phenyl]but-3-enoate is sourced from PubChem (CID 162522824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).