C22H24Cl2FNO3 — CID 162522904
(E)-3-[3,5-dichloro-4-[(2-fluoro-4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]-N-methoxy-N,2-dimethylprop-2-enamide (PubChem CID 162522904) has the molecular formula C22H24Cl2FNO3 and a molecular weight of 440.34 g/mol. Its IUPAC name is (E)-3-[3,5-dichloro-4-[(2-fluoro-4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]-N-methoxy-N,2-dimethylprop-2-enamide.
| Compound Name | (E)-3-[3,5-dichloro-4-[(2-fluoro-4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]-N-methoxy-N,2-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 162522904 |
| Molecular Formula | C22H24Cl2FNO3 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | (E)-3-[3,5-dichloro-4-[(2-fluoro-4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]-N-methoxy-N,2-dimethylprop-2-enamide |
| SMILES | CON(C)C(=O)/C(C)=C/c1cc(Cl)c(Cc2ccc(O)c(C(C)C)c2F)c(Cl)c1 |
| InChI | InChI=1S/C22H24Cl2FNO3/c1-12(2)20-19(27)7-6-15(21(20)25)11-16-17(23)9-14(10-18(16)24)8-13(3)22(28)26(4)29-5/h6-10,12,27H,11H2,1-5H3/b13-8+ |
| InChIKey | PVBBWAGEVLJEEA-MDWZMJQESA-N |
| XLogP | 5.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|