About 2-[4,5-bis(trifluoromethyl)pyrimidin-2-yl]acetonitrile
2-[4,5-bis(trifluoromethyl)pyrimidin-2-yl]acetonitrile (PubChem CID 162523531) has the molecular formula C8H3F6N3
and a molecular weight of 255.12 g/mol. Its IUPAC name is 2-[4,5-bis(trifluoromethyl)pyrimidin-2-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[4,5-bis(trifluoromethyl)pyrimidin-2-yl]acetonitrile |
| PubChem CID | 162523531 |
| Molecular Formula | C8H3F6N3 |
| Molecular Weight | 255.12 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 2-[4,5-bis(trifluoromethyl)pyrimidin-2-yl]acetonitrile |
| SMILES | N#CCc1ncc(C(F)(F)F)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H3F6N3/c9-7(10,11)4-3-16-5(1-2-15)17-6(4)8(12,13)14/h3H,1H2 |
| InChIKey | NCIXRQXSJVXBMA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.12 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4,5-bis(trifluoromethyl)pyrimidin-2-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,5-bis(trifluoromethyl)pyrimidin-2-yl]acetonitrile?
The IUPAC name of 2-[4,5-bis(trifluoromethyl)pyrimidin-2-yl]acetonitrile (CID 162523531) is 2-[4,5-bis(trifluoromethyl)pyrimidin-2-yl]acetonitrile.
What is the SMILES notation for 2-[4,5-bis(trifluoromethyl)pyrimidin-2-yl]acetonitrile?
The canonical SMILES for 2-[4,5-bis(trifluoromethyl)pyrimidin-2-yl]acetonitrile is N#CCc1ncc(C(F)(F)F)c(C(F)(F)F)n1.
What is the InChIKey of 2-[4,5-bis(trifluoromethyl)pyrimidin-2-yl]acetonitrile?
The InChIKey is NCIXRQXSJVXBMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F6N3/c9-7(10,11)4-3-16-5(1-2-15)17-6(4)8(12,13)14/h3H,1H2.
What are the key properties of 2-[4,5-bis(trifluoromethyl)pyrimidin-2-yl]acetonitrile?
2-[4,5-bis(trifluoromethyl)pyrimidin-2-yl]acetonitrile has a molecular weight of 255.12 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,5-bis(trifluoromethyl)pyrimidin-2-yl]acetonitrile is sourced from PubChem (CID 162523531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).