C6HCl5OY — CID 162524677
2,3,4,5,6-pentachlorophenol;yttrium (PubChem CID 162524677) has the molecular formula C6HCl5OY and a molecular weight of 355.24 g/mol. Its IUPAC name is 2,3,4,5,6-pentachlorophenol;yttrium.
| Compound Name | 2,3,4,5,6-pentachlorophenol;yttrium |
|---|---|
| PubChem CID | 162524677 |
| Molecular Formula | C6HCl5OY |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 352.75 |
| IUPAC Name | 2,3,4,5,6-pentachlorophenol;yttrium |
| SMILES | Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.[Y] |
| InChI | InChI=1S/C6HCl5O.Y/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h12H; |
| InChIKey | YGOIMRKKWDPGQR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|