C20H38N2O4 — CID 162524759
3,4-dihydroxybenzaldehyde;3-[2,2-dimethyl-3-(methylamino)propoxy]-2,2-dimethylpropan-1-amine;ethane (PubChem CID 162524759) has the molecular formula C20H38N2O4 and a molecular weight of 370.53 g/mol. Its IUPAC name is 3,4-dihydroxybenzaldehyde;3-[2,2-dimethyl-3-(methylamino)propoxy]-2,2-dimethylpropan-1-amine;ethane.
| Compound Name | 3,4-dihydroxybenzaldehyde;3-[2,2-dimethyl-3-(methylamino)propoxy]-2,2-dimethylpropan-1-amine;ethane |
|---|---|
| PubChem CID | 162524759 |
| Molecular Formula | C20H38N2O4 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | 3,4-dihydroxybenzaldehyde;3-[2,2-dimethyl-3-(methylamino)propoxy]-2,2-dimethylpropan-1-amine;ethane |
| SMILES | CC.CNCC(C)(C)COCC(C)(C)CN.O=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H26N2O.C7H6O3.C2H6/c1-10(2,6-12)8-14-9-11(3,4)7-13-5;8-4-5-1-2-6(9)7(10)3-5;1-2/h13H,6-9,12H2,1-5H3;1-4,9-10H;1-2H3 |
| InChIKey | BCJBKVPDPDUFRX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|