C23H22F2N2O3S2 — CID 162524938
N-[(2,4-difluorophenyl)methyl]-N-(2-methylpropyl)-3-[(E)-3-oxo-1-(1,3-thiazol-2-yl)prop-1-en-2-yl]benzenesulfonamide (PubChem CID 162524938) has the molecular formula C23H22F2N2O3S2 and a molecular weight of 476.57 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-N-(2-methylpropyl)-3-[(E)-3-oxo-1-(1,3-thiazol-2-yl)prop-1-en-2-yl]benzenesulfonamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-N-(2-methylpropyl)-3-[(E)-3-oxo-1-(1,3-thiazol-2-yl)prop-1-en-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 162524938 |
| Molecular Formula | C23H22F2N2O3S2 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-N-(2-methylpropyl)-3-[(E)-3-oxo-1-(1,3-thiazol-2-yl)prop-1-en-2-yl]benzenesulfonamide |
| SMILES | CC(C)CN(Cc1ccc(F)cc1F)S(=O)(=O)c1cccc(/C(C=O)=C\c2nccs2)c1 |
| InChI | InChI=1S/C23H22F2N2O3S2/c1-16(2)13-27(14-18-6-7-20(24)12-22(18)25)32(29,30)21-5-3-4-17(10-21)19(15-28)11-23-26-8-9-31-23/h3-12,15-16H,13-14H2,1-2H3/b19-11- |
| InChIKey | HLWXQDYLSHOVRP-ODLFYWEKSA-N |
| XLogP | 5.01 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|