C20H31NS2 — CID 162525363
3-(1-ethylsulfanylethyl)-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide;molecular hydrogen (PubChem CID 162525363) has the molecular formula C20H31NS2 and a molecular weight of 349.61 g/mol. Its IUPAC name is 3-(1-ethylsulfanylethyl)-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide;molecular hydrogen.
| Compound Name | 3-(1-ethylsulfanylethyl)-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide;molecular hydrogen |
|---|---|
| PubChem CID | 162525363 |
| Molecular Formula | C20H31NS2 |
| Molecular Weight | 349.61 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 3-(1-ethylsulfanylethyl)-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide;molecular hydrogen |
| SMILES | CCSC(C)C1CC2(C(N)=S)CCCC(c3ccccc3)(C1)C2.[H][H] |
| InChI | InChI=1S/C20H29NS2.H2/c1-3-23-15(2)16-12-19(17-8-5-4-6-9-17)10-7-11-20(13-16,14-19)18(21)22;/h4-6,8-9,15-16H,3,7,10-14H2,1-2H3,(H2,21,22);1H |
| InChIKey | ZCCZSLORPMHMSV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|