About (6E)-3,7-dimethyl-1-phenyl-6-prop-2-enylidenebicyclo[3.3.1]nonane-3-carboxylic acid
(6E)-3,7-dimethyl-1-phenyl-6-prop-2-enylidenebicyclo[3.3.1]nonane-3-carboxylic acid (PubChem CID 162525408) has the molecular formula C21H26O2
and a molecular weight of 310.44 g/mol. Its IUPAC name is (6E)-3,7-dimethyl-1-phenyl-6-prop-2-enylidenebicyclo[3.3.1]nonane-3-carboxylic acid.
Molecular Properties
| Compound Name | (6E)-3,7-dimethyl-1-phenyl-6-prop-2-enylidenebicyclo[3.3.1]nonane-3-carboxylic acid |
| PubChem CID | 162525408 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (6E)-3,7-dimethyl-1-phenyl-6-prop-2-enylidenebicyclo[3.3.1]nonane-3-carboxylic acid |
| SMILES | C=C/C=C1\C(C)CC2(c3ccccc3)CC1CC(C)(C(=O)O)C2 |
| InChI | InChI=1S/C21H26O2/c1-4-8-18-15(2)11-21(17-9-6-5-7-10-17)13-16(18)12-20(3,14-21)19(22)23/h4-10,15-16H,1,11-14H2,2-3H3,(H,22,23)/b18-8+ |
| InChIKey | FZXBMOYJZXUAPR-QGMBQPNBSA-N |
| XLogP | 4.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6E)-3,7-dimethyl-1-phenyl-6-prop-2-enylidenebicyclo[3.3.1]nonane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-3,7-dimethyl-1-phenyl-6-prop-2-enylidenebicyclo[3.3.1]nonane-3-carboxylic acid?
The IUPAC name of (6E)-3,7-dimethyl-1-phenyl-6-prop-2-enylidenebicyclo[3.3.1]nonane-3-carboxylic acid (CID 162525408) is (6E)-3,7-dimethyl-1-phenyl-6-prop-2-enylidenebicyclo[3.3.1]nonane-3-carboxylic acid.
What is the SMILES notation for (6E)-3,7-dimethyl-1-phenyl-6-prop-2-enylidenebicyclo[3.3.1]nonane-3-carboxylic acid?
The canonical SMILES for (6E)-3,7-dimethyl-1-phenyl-6-prop-2-enylidenebicyclo[3.3.1]nonane-3-carboxylic acid is C=C/C=C1\C(C)CC2(c3ccccc3)CC1CC(C)(C(=O)O)C2.
What is the InChIKey of (6E)-3,7-dimethyl-1-phenyl-6-prop-2-enylidenebicyclo[3.3.1]nonane-3-carboxylic acid?
The InChIKey is FZXBMOYJZXUAPR-QGMBQPNBSA-N. The full InChI is InChI=1S/C21H26O2/c1-4-8-18-15(2)11-21(17-9-6-5-7-10-17)13-16(18)12-20(3,14-21)19(22)23/h4-10,15-16H,1,11-14H2,2-3H3,(H,22,23)/b18-8+.
What are the key properties of (6E)-3,7-dimethyl-1-phenyl-6-prop-2-enylidenebicyclo[3.3.1]nonane-3-carboxylic acid?
(6E)-3,7-dimethyl-1-phenyl-6-prop-2-enylidenebicyclo[3.3.1]nonane-3-carboxylic acid has a molecular weight of 310.44 g/mol, XLogP of 4.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-3,7-dimethyl-1-phenyl-6-prop-2-enylidenebicyclo[3.3.1]nonane-3-carboxylic acid is sourced from PubChem (CID 162525408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).