C27H36N2O — CID 162525423
(5R)-N-[(8R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]-5-methyl-3-phenyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxamide (PubChem CID 162525423) has the molecular formula C27H36N2O and a molecular weight of 404.60 g/mol. Its IUPAC name is (5R)-N-[(8R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]-5-methyl-3-phenyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxamide.
| Compound Name | (5R)-N-[(8R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]-5-methyl-3-phenyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxamide |
|---|---|
| PubChem CID | 162525423 |
| Molecular Formula | C27H36N2O |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | (5R)-N-[(8R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]-5-methyl-3-phenyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxamide |
| SMILES | C[C@@]12CC3CC4(C(=O)N[C@@H]5CCCN6CCC[C@H]56)CC(c5ccccc5)(C1)C2(C3)C4 |
| InChI | InChI=1S/C27H36N2O/c1-24-13-19-14-25(23(30)28-21-9-5-11-29-12-6-10-22(21)29)17-26(16-24,27(24,15-19)18-25)20-7-3-2-4-8-20/h2-4,7-8,19,21-22H,5-6,9-18H2,1H3,(H,28,30)/t19?,21-,22-,24-,25?,26?,27?/m1/s1 |
| InChIKey | WQCODPZIOMICIK-CZZMUKQUSA-N |
| XLogP | 4.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |