C26H42N2O — CID 162525574
4-aminopiperidine-1-carbaldehyde;3-ethyl-3,7,7-trimethyl-1-phenylbicyclo[3.3.1]nonane (PubChem CID 162525574) has the molecular formula C26H42N2O and a molecular weight of 398.64 g/mol. Its IUPAC name is 4-aminopiperidine-1-carbaldehyde;3-ethyl-3,7,7-trimethyl-1-phenylbicyclo[3.3.1]nonane.
| Compound Name | 4-aminopiperidine-1-carbaldehyde;3-ethyl-3,7,7-trimethyl-1-phenylbicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 162525574 |
| Molecular Formula | C26H42N2O |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.33 |
| IUPAC Name | 4-aminopiperidine-1-carbaldehyde;3-ethyl-3,7,7-trimethyl-1-phenylbicyclo[3.3.1]nonane |
| SMILES | CCC1(C)CC2CC(C)(C)CC(c3ccccc3)(C2)C1.NC1CCN(C=O)CC1 |
| InChI | InChI=1S/C20H30.C6H12N2O/c1-5-19(4)12-16-11-18(2,3)14-20(13-16,15-19)17-9-7-6-8-10-17;7-6-1-3-8(5-9)4-2-6/h6-10,16H,5,11-15H2,1-4H3;5-6H,1-4,7H2 |
| InChIKey | DLMZULWOQXGVMX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|