C20H29F2NS — CID 162525967
6-(difluoromethyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane;methanethioamide (PubChem CID 162525967) has the molecular formula C20H29F2NS and a molecular weight of 353.52 g/mol. Its IUPAC name is 6-(difluoromethyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane;methanethioamide.
| Compound Name | 6-(difluoromethyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane;methanethioamide |
|---|---|
| PubChem CID | 162525967 |
| Molecular Formula | C20H29F2NS |
| Molecular Weight | 353.52 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 6-(difluoromethyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane;methanethioamide |
| SMILES | CC1CC2(c3ccccc3)CC(CC(C)(C)C2)C1C(F)F.NC=S |
| InChI | InChI=1S/C19H26F2.CH3NS/c1-13-9-19(15-7-5-4-6-8-15)11-14(16(13)17(20)21)10-18(2,3)12-19;2-1-3/h4-8,13-14,16-17H,9-12H2,1-3H3;1H,(H2,2,3) |
| InChIKey | VSZVKUGWSZMWMC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|