About 6,6-difluoro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide
6,6-difluoro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide (PubChem CID 162526169) has the molecular formula C16H17F2NO
and a molecular weight of 277.31 g/mol. Its IUPAC name is 6,6-difluoro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide.
Molecular Properties
| Compound Name | 6,6-difluoro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide |
| PubChem CID | 162526169 |
| Molecular Formula | C16H17F2NO |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 6,6-difluoro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide |
| SMILES | NC(=O)C12CC3CC(c4ccccc4)(CC1C3(F)F)C2 |
| InChI | InChI=1S/C16H17F2NO/c17-16(18)11-6-14(10-4-2-1-3-5-10)8-12(16)15(7-11,9-14)13(19)20/h1-5,11-12H,6-9H2,(H2,19,20) |
| InChIKey | HBYTTXVCKFJVGK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,6-difluoro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-difluoro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide?
The IUPAC name of 6,6-difluoro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide (CID 162526169) is 6,6-difluoro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide.
What is the SMILES notation for 6,6-difluoro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide?
The canonical SMILES for 6,6-difluoro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide is NC(=O)C12CC3CC(c4ccccc4)(CC1C3(F)F)C2.
What is the InChIKey of 6,6-difluoro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide?
The InChIKey is HBYTTXVCKFJVGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2NO/c17-16(18)11-6-14(10-4-2-1-3-5-10)8-12(16)15(7-11,9-14)13(19)20/h1-5,11-12H,6-9H2,(H2,19,20).
What are the key properties of 6,6-difluoro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide?
6,6-difluoro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide has a molecular weight of 277.31 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-difluoro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide is sourced from PubChem (CID 162526169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).