About 2-chloro-N-[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrimidine-4-carboxamide
2-chloro-N-[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrimidine-4-carboxamide (PubChem CID 162526958) has the molecular formula C11H14ClFN4O
and a molecular weight of 272.71 g/mol. Its IUPAC name is 2-chloro-N-[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | 2-chloro-N-[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrimidine-4-carboxamide |
| PubChem CID | 162526958 |
| Molecular Formula | C11H14ClFN4O |
| Molecular Weight | 272.71 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-chloro-N-[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrimidine-4-carboxamide |
| SMILES | CN1CC[C@H](NC(=O)c2ccnc(Cl)n2)[C@H](F)C1 |
| InChI | InChI=1S/C11H14ClFN4O/c1-17-5-3-8(7(13)6-17)15-10(18)9-2-4-14-11(12)16-9/h2,4,7-8H,3,5-6H2,1H3,(H,15,18)/t7-,8+/m1/s1 |
| InChIKey | VALZHAODRFGJRU-SFYZADRCSA-N |
| XLogP | 0.90 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.71 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrimidine-4-carboxamide?
The IUPAC name of 2-chloro-N-[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrimidine-4-carboxamide (CID 162526958) is 2-chloro-N-[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrimidine-4-carboxamide.
What is the SMILES notation for 2-chloro-N-[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrimidine-4-carboxamide?
The canonical SMILES for 2-chloro-N-[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrimidine-4-carboxamide is CN1CC[C@H](NC(=O)c2ccnc(Cl)n2)[C@H](F)C1.
What is the InChIKey of 2-chloro-N-[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrimidine-4-carboxamide?
The InChIKey is VALZHAODRFGJRU-SFYZADRCSA-N. The full InChI is InChI=1S/C11H14ClFN4O/c1-17-5-3-8(7(13)6-17)15-10(18)9-2-4-14-11(12)16-9/h2,4,7-8H,3,5-6H2,1H3,(H,15,18)/t7-,8+/m1/s1.
What are the key properties of 2-chloro-N-[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrimidine-4-carboxamide?
2-chloro-N-[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrimidine-4-carboxamide has a molecular weight of 272.71 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]pyrimidine-4-carboxamide is sourced from PubChem (CID 162526958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).