C25H25N5O2 — CID 162527100
3-amino-N-(1-methyl-3,4-dihydro-2H-pyridin-5-yl)-6-[8-(prop-2-enoylamino)naphthalen-2-yl]pyridine-2-carboxamide (PubChem CID 162527100) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 3-amino-N-(1-methyl-3,4-dihydro-2H-pyridin-5-yl)-6-[8-(prop-2-enoylamino)naphthalen-2-yl]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(1-methyl-3,4-dihydro-2H-pyridin-5-yl)-6-[8-(prop-2-enoylamino)naphthalen-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162527100 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 3-amino-N-(1-methyl-3,4-dihydro-2H-pyridin-5-yl)-6-[8-(prop-2-enoylamino)naphthalen-2-yl]pyridine-2-carboxamide |
| SMILES | C=CC(=O)Nc1cccc2ccc(-c3ccc(N)c(C(=O)NC4=CN(C)CCC4)n3)cc12 |
| InChI | InChI=1S/C25H25N5O2/c1-3-23(31)28-22-8-4-6-16-9-10-17(14-19(16)22)21-12-11-20(26)24(29-21)25(32)27-18-7-5-13-30(2)15-18/h3-4,6,8-12,14-15H,1,5,7,13,26H2,2H3,(H,27,32)(H,28,31) |
| InChIKey | SEIPCAPQXJTOSZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|