C31H40N6O3 — CID 162527168
2-[[[7-(4-formylpyrimidin-2-yl)-2-(2-methoxyethoxy)naphthalen-1-yl]amino]methyl]prop-2-enenitrile;1-N,4-N,4-N-trimethylcyclohexane-1,4-diamine (PubChem CID 162527168) has the molecular formula C31H40N6O3 and a molecular weight of 544.70 g/mol. Its IUPAC name is 2-[[[7-(4-formylpyrimidin-2-yl)-2-(2-methoxyethoxy)naphthalen-1-yl]amino]methyl]prop-2-enenitrile;1-N,4-N,4-N-trimethylcyclohexane-1,4-diamine.
| Compound Name | 2-[[[7-(4-formylpyrimidin-2-yl)-2-(2-methoxyethoxy)naphthalen-1-yl]amino]methyl]prop-2-enenitrile;1-N,4-N,4-N-trimethylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 162527168 |
| Molecular Formula | C31H40N6O3 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | 2-[[[7-(4-formylpyrimidin-2-yl)-2-(2-methoxyethoxy)naphthalen-1-yl]amino]methyl]prop-2-enenitrile;1-N,4-N,4-N-trimethylcyclohexane-1,4-diamine |
| SMILES | C=C(C#N)CNc1c(OCCOC)ccc2ccc(-c3nccc(C=O)n3)cc12.CNC1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C22H20N4O3.C9H20N2/c1-15(12-23)13-25-21-19-11-17(22-24-8-7-18(14-27)26-22)4-3-16(19)5-6-20(21)29-10-9-28-2;1-10-8-4-6-9(7-5-8)11(2)3/h3-8,11,14,25H,1,9-10,13H2,2H3;8-10H,4-7H2,1-3H3 |
| InChIKey | VFUPRJNFJWPGCR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|