C25H24N4O3 — CID 162527189
tert-butyl N-[1-(2-carbamoyl-7-pyridin-2-ylnaphthalen-1-yl)-2-cyanoprop-2-enyl]carbamate (PubChem CID 162527189) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is tert-butyl N-[1-(2-carbamoyl-7-pyridin-2-ylnaphthalen-1-yl)-2-cyanoprop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[1-(2-carbamoyl-7-pyridin-2-ylnaphthalen-1-yl)-2-cyanoprop-2-enyl]carbamate |
|---|---|
| PubChem CID | 162527189 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | tert-butyl N-[1-(2-carbamoyl-7-pyridin-2-ylnaphthalen-1-yl)-2-cyanoprop-2-enyl]carbamate |
| SMILES | C=C(C#N)C(NC(=O)OC(C)(C)C)c1c(C(N)=O)ccc2ccc(-c3ccccn3)cc12 |
| InChI | InChI=1S/C25H24N4O3/c1-15(14-26)22(29-24(31)32-25(2,3)4)21-18(23(27)30)11-10-16-8-9-17(13-19(16)21)20-7-5-6-12-28-20/h5-13,22H,1H2,2-4H3,(H2,27,30)(H,29,31) |
| InChIKey | JLFKNRNXQVWONZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|