C26H27F3N4O3 — CID 162527792
3-methoxypropanal;2-[[[7-[4-(methylamino)-2-pyridinyl]-2-(2,2,2-trifluoroethoxy)naphthalen-1-yl]amino]methyl]prop-2-enenitrile (PubChem CID 162527792) has the molecular formula C26H27F3N4O3 and a molecular weight of 500.52 g/mol. Its IUPAC name is 3-methoxypropanal;2-[[[7-[4-(methylamino)-2-pyridinyl]-2-(2,2,2-trifluoroethoxy)naphthalen-1-yl]amino]methyl]prop-2-enenitrile.
| Compound Name | 3-methoxypropanal;2-[[[7-[4-(methylamino)-2-pyridinyl]-2-(2,2,2-trifluoroethoxy)naphthalen-1-yl]amino]methyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 162527792 |
| Molecular Formula | C26H27F3N4O3 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 3-methoxypropanal;2-[[[7-[4-(methylamino)-2-pyridinyl]-2-(2,2,2-trifluoroethoxy)naphthalen-1-yl]amino]methyl]prop-2-enenitrile |
| SMILES | C=C(C#N)CNc1c(OCC(F)(F)F)ccc2ccc(-c3cc(NC)ccn3)cc12.COCCC=O |
| InChI | InChI=1S/C22H19F3N4O.C4H8O2/c1-14(11-26)12-29-21-18-9-16(19-10-17(27-2)7-8-28-19)4-3-15(18)5-6-20(21)30-13-22(23,24)25;1-6-4-2-3-5/h3-10,29H,1,12-13H2,2H3,(H,27,28);3H,2,4H2,1H3 |
| InChIKey | ZZUABGVTHBOOQI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|