C23H19F3N4O2 — CID 162528123
6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (PubChem CID 162528123) has the molecular formula C23H19F3N4O2 and a molecular weight of 440.43 g/mol. Its IUPAC name is 6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide.
| Compound Name | 6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162528123 |
| Molecular Formula | C23H19F3N4O2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| SMILES | C=C(C#N)CNc1c(OC)ccc2ccc(-c3cccc(C(=O)NCC(F)(F)F)n3)cc12 |
| InChI | InChI=1S/C23H19F3N4O2/c1-14(11-27)12-28-21-17-10-16(7-6-15(17)8-9-20(21)32-2)18-4-3-5-19(30-18)22(31)29-13-23(24,25)26/h3-10,28H,1,12-13H2,2H3,(H,29,31) |
| InChIKey | IMYDWXUXTYVXPR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|