C19H15N5O — CID 162528289
2-[[7-(3-methyl-2H-pyrazolo[3,4-c]pyridin-5-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile (PubChem CID 162528289) has the molecular formula C19H15N5O and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-[[7-(3-methyl-2H-pyrazolo[3,4-c]pyridin-5-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile.
| Compound Name | 2-[[7-(3-methyl-2H-pyrazolo[3,4-c]pyridin-5-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 162528289 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-[[7-(3-methyl-2H-pyrazolo[3,4-c]pyridin-5-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile |
| SMILES | C=C(C#N)CN1Cc2c(cccc2-c2cc3c(C)[nH]nc3cn2)C1=O |
| InChI | InChI=1S/C19H15N5O/c1-11(7-20)9-24-10-16-13(4-3-5-14(16)19(24)25)17-6-15-12(2)22-23-18(15)8-21-17/h3-6,8H,1,9-10H2,2H3,(H,22,23) |
| InChIKey | BXZJQZCCGYZFQX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|