C26H24N6O2 — CID 162528408
2-[[7-[3-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indazol-5-yl]-4-amino-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile (PubChem CID 162528408) has the molecular formula C26H24N6O2 and a molecular weight of 452.52 g/mol. Its IUPAC name is 2-[[7-[3-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indazol-5-yl]-4-amino-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile.
| Compound Name | 2-[[7-[3-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indazol-5-yl]-4-amino-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 162528408 |
| Molecular Formula | C26H24N6O2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 2-[[7-[3-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indazol-5-yl]-4-amino-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile |
| SMILES | C=C(C#N)CN1Cc2c(-c3ccc4[nH]nc(C5=CCN(C(C)=O)CC5)c4c3)ccc(N)c2C1=O |
| InChI | InChI=1S/C26H24N6O2/c1-15(12-27)13-32-14-21-19(4-5-22(28)24(21)26(32)34)18-3-6-23-20(11-18)25(30-29-23)17-7-9-31(10-8-17)16(2)33/h3-7,11H,1,8-10,13-14,28H2,2H3,(H,29,30) |
| InChIKey | ZZDQSXXMAKIJJV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|