C19H14N4O — CID 162528484
2-[[7-(1H-indazol-3-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile (PubChem CID 162528484) has the molecular formula C19H14N4O and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-[[7-(1H-indazol-3-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile.
| Compound Name | 2-[[7-(1H-indazol-3-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 162528484 |
| Molecular Formula | C19H14N4O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-[[7-(1H-indazol-3-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile |
| SMILES | C=C(C#N)CN1Cc2c(cccc2-c2n[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C19H14N4O/c1-12(9-20)10-23-11-16-13(6-4-7-14(16)19(23)24)18-15-5-2-3-8-17(15)21-22-18/h2-8H,1,10-11H2,(H,21,22) |
| InChIKey | NREZLSTUQRZZPJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|