C26H30N6O2 — CID 162529445
2-[[7-(3-methyl-2H-indazol-5-yl)-5-[(1-methylpiperidin-4-yl)amino]-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enamide (PubChem CID 162529445) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is 2-[[7-(3-methyl-2H-indazol-5-yl)-5-[(1-methylpiperidin-4-yl)amino]-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enamide.
| Compound Name | 2-[[7-(3-methyl-2H-indazol-5-yl)-5-[(1-methylpiperidin-4-yl)amino]-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 162529445 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 2-[[7-(3-methyl-2H-indazol-5-yl)-5-[(1-methylpiperidin-4-yl)amino]-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enamide |
| SMILES | C=C(CN1Cc2c(cc(NC3CCN(C)CC3)cc2-c2ccc3n[nH]c(C)c3c2)C1=O)C(N)=O |
| InChI | InChI=1S/C26H30N6O2/c1-15(25(27)33)13-32-14-23-21(17-4-5-24-20(10-17)16(2)29-30-24)11-19(12-22(23)26(32)34)28-18-6-8-31(3)9-7-18/h4-5,10-12,18,28H,1,6-9,13-14H2,2-3H3,(H2,27,33)(H,29,30) |
| InChIKey | YTLPVWXTWMSRRG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|