About CID 162530604
CID 162530604 (PubChem CID 162530604) has the molecular formula C19H19BrF2N3O2S2-
and a molecular weight of 503.41 g/mol.
Molecular Properties
| Compound Name | CID 162530604 |
| PubChem CID | 162530604 |
| Molecular Formula | C19H19BrF2N3O2S2- |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 502.01 |
| IUPAC Name | — |
| SMILES | CSc1nc2cc(Br)c(C(Cc3cc(F)cc(F)c3)/N=[S-](=O)/C(C)(C)C)nc2o1 |
| InChI | InChI=1S/C19H19BrF2N3O2S2/c1-19(2,3)29(26)25-14(7-10-5-11(21)8-12(22)6-10)16-13(20)9-15-17(24-16)27-18(23-15)28-4/h5-6,8-9,14H,7H2,1-4H3/q-1 |
| InChIKey | ZYKIVNLFCJWRMO-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 68.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 162530604 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162530604?
The IUPAC name of CID 162530604 (CID 162530604) is not available.
What is the SMILES notation for CID 162530604?
The canonical SMILES for CID 162530604 is CSc1nc2cc(Br)c(C(Cc3cc(F)cc(F)c3)/N=[S-](=O)/C(C)(C)C)nc2o1.
What is the InChIKey of CID 162530604?
The InChIKey is ZYKIVNLFCJWRMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19BrF2N3O2S2/c1-19(2,3)29(26)25-14(7-10-5-11(21)8-12(22)6-10)16-13(20)9-15-17(24-16)27-18(23-15)28-4/h5-6,8-9,14H,7H2,1-4H3/q-1.
What are the key properties of CID 162530604?
CID 162530604 has a molecular weight of 503.41 g/mol, XLogP of 6.22, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162530604 is sourced from PubChem (CID 162530604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).