C23H23N5O3 — CID 162530804
3-methoxy-5-[6-(4-pyridin-2-ylpiperazin-1-yl)-1H-benzimidazol-2-yl]benzene-1,2-diol (PubChem CID 162530804) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 3-methoxy-5-[6-(4-pyridin-2-ylpiperazin-1-yl)-1H-benzimidazol-2-yl]benzene-1,2-diol.
| Compound Name | 3-methoxy-5-[6-(4-pyridin-2-ylpiperazin-1-yl)-1H-benzimidazol-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 162530804 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-methoxy-5-[6-(4-pyridin-2-ylpiperazin-1-yl)-1H-benzimidazol-2-yl]benzene-1,2-diol |
| SMILES | COc1cc(-c2nc3ccc(N4CCN(c5ccccn5)CC4)cc3[nH]2)cc(O)c1O |
| InChI | InChI=1S/C23H23N5O3/c1-31-20-13-15(12-19(29)22(20)30)23-25-17-6-5-16(14-18(17)26-23)27-8-10-28(11-9-27)21-4-2-3-7-24-21/h2-7,12-14,29-30H,8-11H2,1H3,(H,25,26) |
| InChIKey | AJYOYIXUPOBFIJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|