C22H19FN4O6 — CID 162530911
2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-3-(3-methyloxetan-3-yl)-N-(1,2-oxazol-3-yl)benzimidazole-5-carboxamide (PubChem CID 162530911) has the molecular formula C22H19FN4O6 and a molecular weight of 454.41 g/mol. Its IUPAC name is 2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-3-(3-methyloxetan-3-yl)-N-(1,2-oxazol-3-yl)benzimidazole-5-carboxamide.
| Compound Name | 2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-3-(3-methyloxetan-3-yl)-N-(1,2-oxazol-3-yl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 162530911 |
| Molecular Formula | C22H19FN4O6 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-3-(3-methyloxetan-3-yl)-N-(1,2-oxazol-3-yl)benzimidazole-5-carboxamide |
| SMILES | COc1cc(-c2nc3ccc(C(=O)Nc4ccon4)cc3n2C2(C)COC2)c(F)c(O)c1O |
| InChI | InChI=1S/C22H19FN4O6/c1-22(9-32-10-22)27-14-7-11(21(30)25-16-5-6-33-26-16)3-4-13(14)24-20(27)12-8-15(31-2)18(28)19(29)17(12)23/h3-8,28-29H,9-10H2,1-2H3,(H,25,26,30) |
| InChIKey | XGIOALVLJRCFEP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 131.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|