C19H20N2O4 — CID 162530950
4-(1-cyclobutyl-5-hydroxybenzimidazol-2-yl)-6-methoxy-3-methylbenzene-1,2-diol (PubChem CID 162530950) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-(1-cyclobutyl-5-hydroxybenzimidazol-2-yl)-6-methoxy-3-methylbenzene-1,2-diol.
| Compound Name | 4-(1-cyclobutyl-5-hydroxybenzimidazol-2-yl)-6-methoxy-3-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 162530950 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 4-(1-cyclobutyl-5-hydroxybenzimidazol-2-yl)-6-methoxy-3-methylbenzene-1,2-diol |
| SMILES | COc1cc(-c2nc3cc(O)ccc3n2C2CCC2)c(C)c(O)c1O |
| InChI | InChI=1S/C19H20N2O4/c1-10-13(9-16(25-2)18(24)17(10)23)19-20-14-8-12(22)6-7-15(14)21(19)11-4-3-5-11/h6-9,11,22-24H,3-5H2,1-2H3 |
| InChIKey | KDIGTBDYUFUJDR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|