C26H27FN6O3S — CID 162531552
3-cyclopropyl-1-[3-(ethylaminosulfanylamino)phenyl]-5-(2-fluoro-4-methylanilino)-8-methyl-6H-pyrido[4,3-d]pyrimidine-2,4,7-trione (PubChem CID 162531552) has the molecular formula C26H27FN6O3S and a molecular weight of 522.61 g/mol. Its IUPAC name is 3-cyclopropyl-1-[3-(ethylaminosulfanylamino)phenyl]-5-(2-fluoro-4-methylanilino)-8-methyl-6H-pyrido[4,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 3-cyclopropyl-1-[3-(ethylaminosulfanylamino)phenyl]-5-(2-fluoro-4-methylanilino)-8-methyl-6H-pyrido[4,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 162531552 |
| Molecular Formula | C26H27FN6O3S |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 3-cyclopropyl-1-[3-(ethylaminosulfanylamino)phenyl]-5-(2-fluoro-4-methylanilino)-8-methyl-6H-pyrido[4,3-d]pyrimidine-2,4,7-trione |
| SMILES | CCNSNc1cccc(-n2c(=O)n(C3CC3)c(=O)c3c(Nc4ccc(C)cc4F)[nH]c(=O)c(C)c32)c1 |
| InChI | InChI=1S/C26H27FN6O3S/c1-4-28-37-31-16-6-5-7-18(13-16)32-22-15(3)24(34)30-23(29-20-11-8-14(2)12-19(20)27)21(22)25(35)33(26(32)36)17-9-10-17/h5-8,11-13,17,28,31H,4,9-10H2,1-3H3,(H2,29,30,34) |
| InChIKey | SWKZCDGHNLBPQF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 112.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|