C23H25N3O3S — CID 162532077
1-[[1-(3-cyclopentyloxyphenyl)sulfanyl-2,3-dihydroindol-5-yl]methyl]imidazolidine-2,4-dione (PubChem CID 162532077) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is 1-[[1-(3-cyclopentyloxyphenyl)sulfanyl-2,3-dihydroindol-5-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 1-[[1-(3-cyclopentyloxyphenyl)sulfanyl-2,3-dihydroindol-5-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 162532077 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 1-[[1-(3-cyclopentyloxyphenyl)sulfanyl-2,3-dihydroindol-5-yl]methyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(Cc2ccc3c(c2)CCN3Sc2cccc(OC3CCCC3)c2)C(=O)N1 |
| InChI | InChI=1S/C23H25N3O3S/c27-22-15-25(23(28)24-22)14-16-8-9-21-17(12-16)10-11-26(21)30-20-7-3-6-19(13-20)29-18-4-1-2-5-18/h3,6-9,12-13,18H,1-2,4-5,10-11,14-15H2,(H,24,27,28) |
| InChIKey | GFAQIAXDULHDOJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|