C20H29FN4O2S — CID 162532171
1-[5-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpentyl]-4-iminoimidazolidin-2-one (PubChem CID 162532171) has the molecular formula C20H29FN4O2S and a molecular weight of 408.54 g/mol. Its IUPAC name is 1-[5-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpentyl]-4-iminoimidazolidin-2-one.
| Compound Name | 1-[5-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpentyl]-4-iminoimidazolidin-2-one |
|---|---|
| PubChem CID | 162532171 |
| Molecular Formula | C20H29FN4O2S |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 1-[5-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpentyl]-4-iminoimidazolidin-2-one |
| SMILES | [H]/N=C1\CN(CCCCCSNC(C)c2ccc(F)c(OCC3CC3)c2)C(=O)N1 |
| InChI | InChI=1S/C20H29FN4O2S/c1-14(16-7-8-17(21)18(11-16)27-13-15-5-6-15)24-28-10-4-2-3-9-25-12-19(22)23-20(25)26/h7-8,11,14-15,24H,2-6,9-10,12-13H2,1H3,(H2,22,23,26) |
| InChIKey | SGAVMSPBKQAYEL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 77.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|